C17H27N3O2 — CID 42461957
2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-prop-2-enyl-N-prop-2-ynylacetamide (PubChem CID 42461957) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-prop-2-enyl-N-prop-2-ynylacetamide.
| Compound Name | 2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-prop-2-enyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 42461957 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-prop-2-enyl-N-prop-2-ynylacetamide |
| SMILES | C#CCN(CC=C)C(=O)C[C@@H]1C(=O)NCCN1CCC(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-5-9-20(10-6-2)16(21)13-15-17(22)18-8-12-19(15)11-7-14(3)4/h1,6,14-15H,2,7-13H2,3-4H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | SZCIHJWKDXADNB-OAHLLOKOSA-N |
| XLogP | 0.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|