C23H21BrN2O2S — CID 4246214
4-[[(4-bromophenyl)methyl-[(2-methylphenyl)carbamothioyl]amino]methyl]benzoic acid (PubChem CID 4246214) has the molecular formula C23H21BrN2O2S and a molecular weight of 469.40 g/mol. Its IUPAC name is 4-[[(4-bromophenyl)methyl-[(2-methylphenyl)carbamothioyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[(4-bromophenyl)methyl-[(2-methylphenyl)carbamothioyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 4246214 |
| Molecular Formula | C23H21BrN2O2S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 4-[[(4-bromophenyl)methyl-[(2-methylphenyl)carbamothioyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccccc1NC(=S)N(Cc1ccc(Br)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H21BrN2O2S/c1-16-4-2-3-5-21(16)25-23(29)26(15-18-8-12-20(24)13-9-18)14-17-6-10-19(11-7-17)22(27)28/h2-13H,14-15H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | NNCXGQYJBTXZKC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|