C22H28N4OS — CID 42462871
(1S,5S,7S)-7-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-[(2-methylphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 42462871) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is (1S,5S,7S)-7-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-[(2-methylphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-7-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-[(2-methylphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 42462871 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (1S,5S,7S)-7-[2-(dimethylamino)-1,3-thiazol-5-yl]-3-[(2-methylphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | Cc1ccccc1CN1C[C@@H]2C[C@@H](c3cnc(N(C)C)s3)N3CCC[C@@]23C1=O |
| InChI | InChI=1S/C22H28N4OS/c1-15-7-4-5-8-16(15)13-25-14-17-11-18(19-12-23-21(28-19)24(2)3)26-10-6-9-22(17,26)20(25)27/h4-5,7-8,12,17-18H,6,9-11,13-14H2,1-3H3/t17-,18-,22-/m0/s1 |
| InChIKey | XWUBRHPPTLGECL-SPEDKVCISA-N |
| XLogP | 3.46 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |