C27H34FN3O2 — CID 42464202
N-[(2-fluorophenyl)methyl]-4-[4-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]piperidin-1-yl]benzamide (PubChem CID 42464202) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-[4-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]piperidin-1-yl]benzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-[4-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42464202 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-[4-[(2-hydroxy-2-prop-2-enylpent-4-enyl)amino]piperidin-1-yl]benzamide |
| SMILES | C=CCC(O)(CC=C)CNC1CCN(c2ccc(C(=O)NCc3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C27H34FN3O2/c1-3-15-27(33,16-4-2)20-30-23-13-17-31(18-14-23)24-11-9-21(10-12-24)26(32)29-19-22-7-5-6-8-25(22)28/h3-12,23,30,33H,1-2,13-20H2,(H,29,32) |
| InChIKey | YCZUINYNYSTYEK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|