C25H26N4O2S — CID 42465353
(5R)-5-benzyl-5-[1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42465353) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is (5R)-5-benzyl-5-[1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-5-[1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42465353 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (5R)-5-benzyl-5-[1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@](Cc2ccccc2)(C2CCN(Cc3nc(-c4ccccc4)cs3)CC2)N1 |
| InChI | InChI=1S/C25H26N4O2S/c30-23-25(28-24(31)27-23,15-18-7-3-1-4-8-18)20-11-13-29(14-12-20)16-22-26-21(17-32-22)19-9-5-2-6-10-19/h1-10,17,20H,11-16H2,(H2,27,28,30,31)/t25-/m1/s1 |
| InChIKey | BSTRZXFFMUXUHX-RUZDIDTESA-N |
| XLogP | 3.84 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|