C7H14N2 — CID 4247236
2,4-dimethyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 4247236) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,4-dimethyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 2,4-dimethyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 4247236 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,4-dimethyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CC1CC(N)=NC(C)C1 |
| InChI | InChI=1S/C7H14N2/c1-5-3-6(2)9-7(8)4-5/h5-6H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | RRCBYANJUIVMJX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |