About 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid
2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 4247256) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid.
Molecular Properties
| Compound Name | 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid |
| PubChem CID | 4247256 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(CC(NC(C)=O)C(=O)O)cc1OC |
| InChI | InChI=1S/C13H17NO5/c1-8(15)14-10(13(16)17)6-9-4-5-11(18-2)12(7-9)19-3/h4-5,7,10H,6H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | CDJLVVKXGZXTPW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid?
The IUPAC name of 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid (CID 4247256) is 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid?
The canonical SMILES for 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid is COc1ccc(CC(NC(C)=O)C(=O)O)cc1OC.
What is the InChIKey of 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid?
The InChIKey is CDJLVVKXGZXTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-8(15)14-10(13(16)17)6-9-4-5-11(18-2)12(7-9)19-3/h4-5,7,10H,6H2,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid?
2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid has a molecular weight of 267.28 g/mol, XLogP of 0.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(3,4-dimethoxyphenyl)propanoic acid is sourced from PubChem (CID 4247256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).