C17H17N3OS — CID 42473100
1-[(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 42473100) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 42473100 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCC[C@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H17N3OS/c21-16(10-12-7-9-22-11-12)20-8-3-6-15(20)17-18-13-4-1-2-5-14(13)19-17/h1-2,4-5,7,9,11,15H,3,6,8,10H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | SKWZQUCVINMEAW-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |