C16H15N5O3 — CID 42475324
4-[(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)amino]benzamide (PubChem CID 42475324) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)amino]benzamide.
| Compound Name | 4-[(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)amino]benzamide |
|---|---|
| PubChem CID | 42475324 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)amino]benzamide |
| SMILES | Cn1c(=O)c2c(Nc3ccc(C(N)=O)cc3)ccnc2n(C)c1=O |
| InChI | InChI=1S/C16H15N5O3/c1-20-14-12(15(23)21(2)16(20)24)11(7-8-18-14)19-10-5-3-9(4-6-10)13(17)22/h3-8H,1-2H3,(H2,17,22)(H,18,19) |
| InChIKey | WTAJMIKTZCCJHL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |