C16H19F4N3O3 — CID 4247766
N'-(6,7-dimethoxy-3,3-dimethyl-4H-isoquinolin-1-yl)-2,2,3,3-tetrafluoropropanehydrazide (PubChem CID 4247766) has the molecular formula C16H19F4N3O3 and a molecular weight of 377.34 g/mol. Its IUPAC name is N'-(6,7-dimethoxy-3,3-dimethyl-4H-isoquinolin-1-yl)-2,2,3,3-tetrafluoropropanehydrazide.
| Compound Name | N'-(6,7-dimethoxy-3,3-dimethyl-4H-isoquinolin-1-yl)-2,2,3,3-tetrafluoropropanehydrazide |
|---|---|
| PubChem CID | 4247766 |
| Molecular Formula | C16H19F4N3O3 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N'-(6,7-dimethoxy-3,3-dimethyl-4H-isoquinolin-1-yl)-2,2,3,3-tetrafluoropropanehydrazide |
| SMILES | COc1cc2c(cc1OC)C(NNC(=O)C(F)(F)C(F)F)=NC(C)(C)C2 |
| InChI | InChI=1S/C16H19F4N3O3/c1-15(2)7-8-5-10(25-3)11(26-4)6-9(8)12(21-15)22-23-14(24)16(19,20)13(17)18/h5-6,13H,7H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | PTYIJINWRLBNDF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|