About 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene
7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene (PubChem CID 4247855) has the molecular formula C19H19BrO2
and a molecular weight of 359.26 g/mol. Its IUPAC name is 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene.
Molecular Properties
| Compound Name | 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene |
| PubChem CID | 4247855 |
| Molecular Formula | C19H19BrO2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene |
| SMILES | Cc1c(OCc2ccc(Br)cc2)ccc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C19H19BrO2/c1-13-17(21-12-14-4-7-16(20)8-5-14)9-6-15-10-11-19(2,3)22-18(13)15/h4-11H,12H2,1-3H3 |
| InChIKey | NSQHHDQDUWOFOB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene?
The IUPAC name of 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene (CID 4247855) is 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene.
What is the SMILES notation for 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene?
The canonical SMILES for 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene is Cc1c(OCc2ccc(Br)cc2)ccc2c1OC(C)(C)C=C2.
What is the InChIKey of 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene?
The InChIKey is NSQHHDQDUWOFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrO2/c1-13-17(21-12-14-4-7-16(20)8-5-14)9-6-15-10-11-19(2,3)22-18(13)15/h4-11H,12H2,1-3H3.
What are the key properties of 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene?
7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene has a molecular weight of 359.26 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-bromophenyl)methoxy]-2,2,8-trimethylchromene is sourced from PubChem (CID 4247855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).