C24H22N4O2S2 — CID 42480423
(E)-N-[[5-benzylsulfanyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 42480423) has the molecular formula C24H22N4O2S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is (E)-N-[[5-benzylsulfanyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[5-benzylsulfanyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 42480423 |
| Molecular Formula | C24H22N4O2S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (E)-N-[[5-benzylsulfanyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1ccc(-n2c(CNC(=O)/C=C/c3cccs3)nnc2SCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4O2S2/c1-30-20-11-9-19(10-12-20)28-22(16-25-23(29)14-13-21-8-5-15-31-21)26-27-24(28)32-17-18-6-3-2-4-7-18/h2-15H,16-17H2,1H3,(H,25,29)/b14-13+ |
| InChIKey | PXHQMAKKQMTKLI-BUHFOSPRSA-N |
| XLogP | 4.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|