C22H33N5O4 — CID 42481441
2-methyl-N-[(1R)-1-[7-[(2,4,6-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide (PubChem CID 42481441) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-[7-[(2,4,6-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1R)-1-[7-[(2,4,6-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 42481441 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2-methyl-N-[(1R)-1-[7-[(2,4,6-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]propanamide |
| SMILES | COc1cc(OC)c(CN2CCc3nnc([C@@H](C)NC(=O)C(C)C)n3CC2)c(OC)c1 |
| InChI | InChI=1S/C22H33N5O4/c1-14(2)22(28)23-15(3)21-25-24-20-7-8-26(9-10-27(20)21)13-17-18(30-5)11-16(29-4)12-19(17)31-6/h11-12,14-15H,7-10,13H2,1-6H3,(H,23,28)/t15-/m1/s1 |
| InChIKey | XBCKVYHFAOFRIO-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |