C23H23F3N4O2 — CID 42482821
N-[3-[4-(1,2-oxazol-3-ylmethylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 42482821) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[3-[4-(1,2-oxazol-3-ylmethylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(1,2-oxazol-3-ylmethylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42482821 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[3-[4-(1,2-oxazol-3-ylmethylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(NCc3ccon3)CC2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F3N4O2/c24-23(25,26)17-4-1-3-16(13-17)22(31)28-19-5-2-6-21(14-19)30-10-7-18(8-11-30)27-15-20-9-12-32-29-20/h1-6,9,12-14,18,27H,7-8,10-11,15H2,(H,28,31) |
| InChIKey | FWSMMEADHKSVHQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|