C23H21F3N4O — CID 42483570
(E)-3-pyridin-2-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 42483570) has the molecular formula C23H21F3N4O and a molecular weight of 426.44 g/mol. Its IUPAC name is (E)-3-pyridin-2-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-pyridin-2-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 42483570 |
| Molecular Formula | C23H21F3N4O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (E)-3-pyridin-2-yl-1-[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccn1)N1CCC(c2[nH]ncc2-c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H21F3N4O/c24-23(25,26)18-5-3-4-17(14-18)20-15-28-29-22(20)16-9-12-30(13-10-16)21(31)8-7-19-6-1-2-11-27-19/h1-8,11,14-16H,9-10,12-13H2,(H,28,29)/b8-7+ |
| InChIKey | PSXNLEYEWQGRAM-BQYQJAHWSA-N |
| XLogP | 4.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|