C19H27N3O4 — CID 4248848
N-[(4-tert-butylcyclohexylidene)amino]-2-(4-nitrophenoxy)propanamide (PubChem CID 4248848) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-2-(4-nitrophenoxy)propanamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 4248848 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(4-nitrophenoxy)propanamide |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)NN=C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-13(26-17-11-9-16(10-12-17)22(24)25)18(23)21-20-15-7-5-14(6-8-15)19(2,3)4/h9-14H,5-8H2,1-4H3,(H,21,23)/b20-15- |
| InChIKey | BUCGDPGSTMYUPM-HKWRFOASSA-N |
| XLogP | 4.07 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|