C23H27BrN2O2S — CID 4249115
2-bromo-4,4-dimethyl-2'-phenyl-2-prop-2-enylsulfanylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-7'-ol (PubChem CID 4249115) has the molecular formula C23H27BrN2O2S and a molecular weight of 475.45 g/mol. Its IUPAC name is 2-bromo-4,4-dimethyl-2'-phenyl-2-prop-2-enylsulfanylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-7'-ol.
| Compound Name | 2-bromo-4,4-dimethyl-2'-phenyl-2-prop-2-enylsulfanylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 4249115 |
| Molecular Formula | C23H27BrN2O2S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-bromo-4,4-dimethyl-2'-phenyl-2-prop-2-enylsulfanylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-7'-ol |
| SMILES | C=CCSC1(Br)NC(C)(C)CC2(CC(c3ccccc3)Oc3cc(O)ccc32)N1 |
| InChI | InChI=1S/C23H27BrN2O2S/c1-4-12-29-23(24)25-21(2,3)15-22(26-23)14-20(16-8-6-5-7-9-16)28-19-13-17(27)10-11-18(19)22/h4-11,13,20,25-27H,1,12,14-15H2,2-3H3 |
| InChIKey | LBLNKOBDGQOXLL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|