About methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate
methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate (PubChem CID 4249516) has the molecular formula C13H17BrO4
and a molecular weight of 317.18 g/mol. Its IUPAC name is methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate.
Molecular Properties
| Compound Name | methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate |
| PubChem CID | 4249516 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1C(=O)C2(C)CCC1C2(C)CBr |
| InChI | InChI=1S/C13H17BrO4/c1-12-5-4-7(13(12,2)6-14)8(10(12)16)9(15)11(17)18-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | FTKNJECMSMCSHO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate?
The IUPAC name of methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate (CID 4249516) is methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate.
What is the SMILES notation for methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate?
The canonical SMILES for methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate is COC(=O)C(=O)C1C(=O)C2(C)CCC1C2(C)CBr.
What is the InChIKey of methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate?
The InChIKey is FTKNJECMSMCSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO4/c1-12-5-4-7(13(12,2)6-14)8(10(12)16)9(15)11(17)18-3/h7-8H,4-6H2,1-3H3.
What are the key properties of methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate?
methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate has a molecular weight of 317.18 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]-2-oxoacetate is sourced from PubChem (CID 4249516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).