C20H15N5O6S — CID 42498066
2-[[(4S)-5-cyano-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 42498066) has the molecular formula C20H15N5O6S and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-[[(4S)-5-cyano-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[(4S)-5-cyano-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42498066 |
| Molecular Formula | C20H15N5O6S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-[[(4S)-5-cyano-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | N#CC1=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)NC(=O)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15N5O6S/c21-10-17-16(12-2-1-3-15(8-12)25(30)31)9-18(26)23-20(17)32-11-19(27)22-13-4-6-14(7-5-13)24(28)29/h1-8,16H,9,11H2,(H,22,27)(H,23,26)/t16-/m0/s1 |
| InChIKey | FVSCIFJVDWYTDM-INIZCTEOSA-N |
| XLogP | 3.21 |
| TPSA | 168.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|