C19H24N2O5S2 — CID 42498181
4-[[(3aR,6aS)-3-(4-butylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid (PubChem CID 42498181) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-3-(4-butylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,6aS)-3-(4-butylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 42498181 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[[(3aR,6aS)-3-(4-butylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
| SMILES | CCCCc1ccc(N2/C(=N/C(=O)CCC(=O)O)S[C@@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-2-3-4-13-5-7-14(8-6-13)21-15-11-28(25,26)12-16(15)27-19(21)20-17(22)9-10-18(23)24/h5-8,15-16H,2-4,9-12H2,1H3,(H,23,24)/b20-19-/t15-,16-/m1/s1 |
| InChIKey | MLRGMWLXNGUCAH-WZHXCRBMSA-N |
| XLogP | 2.50 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|