C23H32N2O3S — CID 42500315
4-[2-(benzenesulfonyl)ethyl]-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1,4-diazepan-5-one (PubChem CID 42500315) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)ethyl]-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1,4-diazepan-5-one.
| Compound Name | 4-[2-(benzenesulfonyl)ethyl]-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42500315 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[2-(benzenesulfonyl)ethyl]-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1,4-diazepan-5-one |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCC(=O)N(CCS(=O)(=O)c4ccccc4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C23H32N2O3S/c1-23(2)19-9-8-18(21(23)16-19)17-24-11-10-22(26)25(13-12-24)14-15-29(27,28)20-6-4-3-5-7-20/h3-8,19,21H,9-17H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | ZJKYXMJYDPEAEM-FPOVZHCZSA-N |
| XLogP | 2.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|