C13H14Cl6O — CID 4250145
5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-en-2-ol (PubChem CID 4250145) has the molecular formula C13H14Cl6O and a molecular weight of 398.97 g/mol. Its IUPAC name is 5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-en-2-ol.
| Compound Name | 5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-en-2-ol |
|---|---|
| PubChem CID | 4250145 |
| Molecular Formula | C13H14Cl6O |
| Molecular Weight | 398.97 g/mol |
| Exact Mass | 395.92 |
| IUPAC Name | 5-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)-2-methylpent-3-en-2-ol |
| SMILES | CC(C)(O)C=CCC1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C13H14Cl6O/c1-10(2,20)5-3-4-7-6-11(16)8(14)9(15)12(7,17)13(11,18)19/h3,5,7,20H,4,6H2,1-2H3 |
| InChIKey | VHBIDFMEGPSQJM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|