About 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine
4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine (PubChem CID 4250226) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine |
| PubChem CID | 4250226 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine |
| SMILES | CCCCNC1CS(=O)(=O)CC1Nc1ccccc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-2-3-9-15-13-10-19(17,18)11-14(13)16-12-7-5-4-6-8-12/h4-8,13-16H,2-3,9-11H2,1H3 |
| InChIKey | YTYFYSXDNUDVKJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine?
The IUPAC name of 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine (CID 4250226) is 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine.
What is the SMILES notation for 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine?
The canonical SMILES for 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine is CCCCNC1CS(=O)(=O)CC1Nc1ccccc1.
What is the InChIKey of 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine?
The InChIKey is YTYFYSXDNUDVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2S/c1-2-3-9-15-13-10-19(17,18)11-14(13)16-12-7-5-4-6-8-12/h4-8,13-16H,2-3,9-11H2,1H3.
What are the key properties of 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine?
4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine has a molecular weight of 282.41 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-butyl-1,1-dioxo-3-N-phenylthiolane-3,4-diamine is sourced from PubChem (CID 4250226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).