C23H33N3O2 — CID 42506910
(2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-6-oxo-2-phenylpiperidine-3-carboxamide (PubChem CID 42506910) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-6-oxo-2-phenylpiperidine-3-carboxamide.
| Compound Name | (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-6-oxo-2-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42506910 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-6-oxo-2-phenylpiperidine-3-carboxamide |
| SMILES | CN1C(=O)CC[C@H](C(=O)NC[C@@H]2CCCN3CCCC[C@H]23)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H33N3O2/c1-25-21(27)13-12-19(22(25)17-8-3-2-4-9-17)23(28)24-16-18-10-7-15-26-14-6-5-11-20(18)26/h2-4,8-9,18-20,22H,5-7,10-16H2,1H3,(H,24,28)/t18-,19-,20+,22-/m0/s1 |
| InChIKey | CRTKFYNHSTYBSF-KEZQHZCBSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |