C46H36Cl2N6O5 — CID 4250763
2-[4,5-bis[[bis(pyridin-2-ylmethyl)azaniumyl]methyl]-2,7-dichloro-3-oxido-6-oxoxanthen-9-yl]benzoate (PubChem CID 4250763) has the molecular formula C46H36Cl2N6O5 and a molecular weight of 823.74 g/mol. Its IUPAC name is 2-[4,5-bis[[bis(pyridin-2-ylmethyl)azaniumyl]methyl]-2,7-dichloro-3-oxido-6-oxoxanthen-9-yl]benzoate.
| Compound Name | 2-[4,5-bis[[bis(pyridin-2-ylmethyl)azaniumyl]methyl]-2,7-dichloro-3-oxido-6-oxoxanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 4250763 |
| Molecular Formula | C46H36Cl2N6O5 |
| Molecular Weight | 823.74 g/mol |
| Exact Mass | 822.21 |
| IUPAC Name | 2-[4,5-bis[[bis(pyridin-2-ylmethyl)azaniumyl]methyl]-2,7-dichloro-3-oxido-6-oxoxanthen-9-yl]benzoate |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Cl)c(=O)c(C[NH+](Cc3ccccn3)Cc3ccccn3)c-2oc2c(C[NH+](Cc3ccccn3)Cc3ccccn3)c([O-])c(Cl)cc12 |
| InChI | InChI=1S/C46H36Cl2N6O5/c47-39-21-35-41(33-15-1-2-16-34(33)46(57)58)36-22-40(48)43(56)38(28-54(25-31-13-5-9-19-51-31)26-32-14-6-10-20-52-32)45(36)59-44(35)37(42(39)55)27-53(23-29-11-3-7-17-49-29)24-30-12-4-8-18-50-30/h1-22,55H,23-28H2,(H,57,58) |
| InChIKey | NKEYRLVORYSIBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 153.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|