C11H15Cl3N4O — CID 4251174
2,2-dimethyl-N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]propanamide (PubChem CID 4251174) has the molecular formula C11H15Cl3N4O and a molecular weight of 325.63 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 4251174 |
| Molecular Formula | C11H15Cl3N4O |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(Nc1ncccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H15Cl3N4O/c1-10(2,3)8(19)17-7(11(12,13)14)18-9-15-5-4-6-16-9/h4-7H,1-3H3,(H,17,19)(H,15,16,18) |
| InChIKey | MZGMARCYCFHLTI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|