C26H30N4O — CID 42512495
N-[4-(1H-benzimidazol-2-yl)phenyl]-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidine-4-carboxamide (PubChem CID 42512495) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42512495 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)C1CCN(C[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C26H30N4O/c31-26(21-14-16-30(17-15-21)18-19-6-2-1-3-7-19)27-22-12-10-20(11-13-22)25-28-23-8-4-5-9-24(23)29-25/h1-2,4-5,8-13,19,21H,3,6-7,14-18H2,(H,27,31)(H,28,29)/t19-/m0/s1 |
| InChIKey | MLBCRRGJFPBSNC-IBGZPJMESA-N |
| XLogP | 5.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|