C14H26IN3O3 — CID 4251272
1-hydroxy-N-[3-[(2-iodoacetyl)amino]propyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide (PubChem CID 4251272) has the molecular formula C14H26IN3O3 and a molecular weight of 411.28 g/mol. Its IUPAC name is 1-hydroxy-N-[3-[(2-iodoacetyl)amino]propyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide.
| Compound Name | 1-hydroxy-N-[3-[(2-iodoacetyl)amino]propyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 4251272 |
| Molecular Formula | C14H26IN3O3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-hydroxy-N-[3-[(2-iodoacetyl)amino]propyl]-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCCNC(=O)CI)C(C)(C)N1O |
| InChI | InChI=1S/C14H26IN3O3/c1-13(2)8-10(14(3,4)18(13)21)12(20)17-7-5-6-16-11(19)9-15/h10,21H,5-9H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | YNFHSRKZVIMLQZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|