About N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide
N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide (PubChem CID 42517243) has the molecular formula C18H17F2N3O3
and a molecular weight of 361.35 g/mol. Its IUPAC name is N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| PubChem CID | 42517243 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1=O)NCc1cccnc1Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O3/c19-14-6-5-13(9-15(14)20)26-18-12(3-1-7-21-18)10-22-16(24)11-23-8-2-4-17(23)25/h1,3,5-7,9H,2,4,8,10-11H2,(H,22,24) |
| InChIKey | XRMWTWCEJHXURC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The IUPAC name of N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide (CID 42517243) is N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide.
What is the SMILES notation for N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The canonical SMILES for N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide is O=C(CN1CCCC1=O)NCc1cccnc1Oc1ccc(F)c(F)c1.
What is the InChIKey of N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The InChIKey is XRMWTWCEJHXURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2N3O3/c19-14-6-5-13(9-15(14)20)26-18-12(3-1-7-21-18)10-22-16(24)11-23-8-2-4-17(23)25/h1,3,5-7,9H,2,4,8,10-11H2,(H,22,24).
What are the key properties of N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide?
N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide has a molecular weight of 361.35 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopyrrolidin-1-yl)acetamide is sourced from PubChem (CID 42517243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).