C17H16FN5O — CID 42521611
5-(4-fluorophenyl)-N-(3-pyridin-3-yloxypropyl)-1,2,4-triazin-3-amine (PubChem CID 42521611) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-pyridin-3-yloxypropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(3-pyridin-3-yloxypropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 42521611 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-pyridin-3-yloxypropyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(-c2cnnc(NCCCOc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C17H16FN5O/c18-14-6-4-13(5-7-14)16-12-21-23-17(22-16)20-9-2-10-24-15-3-1-8-19-11-15/h1,3-8,11-12H,2,9-10H2,(H,20,22,23) |
| InChIKey | DJRBJGSXNQBWPD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|