C16H10N4S — CID 4252208
2-methylsulfanyl-4-phenylpenta-1,4-diene-1,1,5,5-tetracarbonitrile (PubChem CID 4252208) has the molecular formula C16H10N4S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-methylsulfanyl-4-phenylpenta-1,4-diene-1,1,5,5-tetracarbonitrile.
| Compound Name | 2-methylsulfanyl-4-phenylpenta-1,4-diene-1,1,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 4252208 |
| Molecular Formula | C16H10N4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-methylsulfanyl-4-phenylpenta-1,4-diene-1,1,5,5-tetracarbonitrile |
| SMILES | CSC(CC(=C(C#N)C#N)c1ccccc1)=C(C#N)C#N |
| InChI | InChI=1S/C16H10N4S/c1-21-16(14(10-19)11-20)7-15(13(8-17)9-18)12-5-3-2-4-6-12/h2-6H,7H2,1H3 |
| InChIKey | VDTXZMKNFLWECL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|