C23H24N2O2 — CID 42522519
(3R)-3-(4-methoxyphenyl)-N-methyl-3-phenyl-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 42522519) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (3R)-3-(4-methoxyphenyl)-N-methyl-3-phenyl-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | (3R)-3-(4-methoxyphenyl)-N-methyl-3-phenyl-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42522519 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3R)-3-(4-methoxyphenyl)-N-methyl-3-phenyl-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | COc1ccc([C@H](CC(=O)N(C)Cc2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c1-25(17-20-10-6-7-15-24-20)23(26)16-22(18-8-4-3-5-9-18)19-11-13-21(27-2)14-12-19/h3-15,22H,16-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | YGLLYVLIZRRHTE-JOCHJYFZSA-N |
| XLogP | 4.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |