C18H19ClFN7O — CID 42523153
4-chloro-1-[4-[3-(4-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]butan-1-one (PubChem CID 42523153) has the molecular formula C18H19ClFN7O and a molecular weight of 403.85 g/mol. Its IUPAC name is 4-chloro-1-[4-[3-(4-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-chloro-1-[4-[3-(4-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42523153 |
| Molecular Formula | C18H19ClFN7O |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 4-chloro-1-[4-[3-(4-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCCl)N1CCN(c2ncnc3c2nnn3-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H19ClFN7O/c19-7-1-2-15(28)25-8-10-26(11-9-25)17-16-18(22-12-21-17)27(24-23-16)14-5-3-13(20)4-6-14/h3-6,12H,1-2,7-11H2 |
| InChIKey | VZCHSNYGXSJYCP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|