About 3-amino-5,5-dimethylcyclohex-2-ene-1-thione
3-amino-5,5-dimethylcyclohex-2-ene-1-thione (PubChem CID 4252426) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 3-amino-5,5-dimethylcyclohex-2-ene-1-thione.
Molecular Properties
| Compound Name | 3-amino-5,5-dimethylcyclohex-2-ene-1-thione |
| PubChem CID | 4252426 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-amino-5,5-dimethylcyclohex-2-ene-1-thione |
| SMILES | CC1(C)CC(=S)C=C(N)C1 |
| InChI | InChI=1S/C8H13NS/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5,9H2,1-2H3 |
| InChIKey | PIVBPWNTHVZUHI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5,5-dimethylcyclohex-2-ene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5-dimethylcyclohex-2-ene-1-thione?
The IUPAC name of 3-amino-5,5-dimethylcyclohex-2-ene-1-thione (CID 4252426) is 3-amino-5,5-dimethylcyclohex-2-ene-1-thione.
What is the SMILES notation for 3-amino-5,5-dimethylcyclohex-2-ene-1-thione?
The canonical SMILES for 3-amino-5,5-dimethylcyclohex-2-ene-1-thione is CC1(C)CC(=S)C=C(N)C1.
What is the InChIKey of 3-amino-5,5-dimethylcyclohex-2-ene-1-thione?
The InChIKey is PIVBPWNTHVZUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5,9H2,1-2H3.
What are the key properties of 3-amino-5,5-dimethylcyclohex-2-ene-1-thione?
3-amino-5,5-dimethylcyclohex-2-ene-1-thione has a molecular weight of 155.27 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5-dimethylcyclohex-2-ene-1-thione is sourced from PubChem (CID 4252426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).