C20H20N2O3S2 — CID 42524355
ethyl 2-[2-(2-ethylsulfanylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 42524355) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is ethyl 2-[2-(2-ethylsulfanylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-ethylsulfanylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 42524355 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | ethyl 2-[2-(2-ethylsulfanylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccccc2SCC)sc2ccccc21 |
| InChI | InChI=1S/C20H20N2O3S2/c1-3-25-18(23)13-22-15-10-6-8-12-17(15)27-20(22)21-19(24)14-9-5-7-11-16(14)26-4-2/h5-12H,3-4,13H2,1-2H3/b21-20- |
| InChIKey | JVHSXHGGSKQDOJ-MRCUWXFGSA-N |
| XLogP | 4.12 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |