C21H19N3O5 — CID 4252488
2,9-dimethyl-17,19-dinitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene (PubChem CID 4252488) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2,9-dimethyl-17,19-dinitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene.
| Compound Name | 2,9-dimethyl-17,19-dinitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 4252488 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2,9-dimethyl-17,19-dinitro-21-oxa-2-azapentacyclo[11.8.0.01,9.03,8.015,20]henicosa-3,5,7,13,15(20),16,18-heptaene |
| SMILES | CN1c2ccccc2C2(C)CCCC3=Cc4cc([N+](=O)[O-])cc([N+](=O)[O-])c4OC312 |
| InChI | InChI=1S/C21H19N3O5/c1-20-9-5-6-14-10-13-11-15(23(25)26)12-18(24(27)28)19(13)29-21(14,20)22(2)17-8-4-3-7-16(17)20/h3-4,7-8,10-12H,5-6,9H2,1-2H3 |
| InChIKey | WZPULXTWYBZUOB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|