C25H32N2O6 — CID 42525029
3,4,5-triethoxy-N-[3-methoxy-4-(2-oxopiperidin-1-yl)phenyl]benzamide (PubChem CID 42525029) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-methoxy-4-(2-oxopiperidin-1-yl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-methoxy-4-(2-oxopiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 42525029 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-methoxy-4-(2-oxopiperidin-1-yl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(N3CCCCC3=O)c(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H32N2O6/c1-5-31-21-14-17(15-22(32-6-2)24(21)33-7-3)25(29)26-18-11-12-19(20(16-18)30-4)27-13-9-8-10-23(27)28/h11-12,14-16H,5-10,13H2,1-4H3,(H,26,29) |
| InChIKey | WKUMVANCZLFGOE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |