C21H24N4O — CID 42525848
5-naphthalen-2-yl-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine (PubChem CID 42525848) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 5-naphthalen-2-yl-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine.
| Compound Name | 5-naphthalen-2-yl-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine |
|---|---|
| PubChem CID | 42525848 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 5-naphthalen-2-yl-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine |
| SMILES | CCCO[C@@H]1CCCN(c2nncc(-c3ccc4ccccc4c3)n2)C1 |
| InChI | InChI=1S/C21H24N4O/c1-2-12-26-19-8-5-11-25(15-19)21-23-20(14-22-24-21)18-10-9-16-6-3-4-7-17(16)13-18/h3-4,6-7,9-10,13-14,19H,2,5,8,11-12,15H2,1H3/t19-/m1/s1 |
| InChIKey | FZPBVSXEPZUBTG-LJQANCHMSA-N |
| XLogP | 4.09 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |