C20H23N3O3 — CID 42527129
ethyl (2S)-1-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]piperidine-2-carboxylate (PubChem CID 42527129) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl (2S)-1-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42527129 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethyl (2S)-1-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCCN1Cc1cn[nH]c1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-25-20(24)16-8-5-6-10-23(16)13-15-12-21-22-19(15)18-11-14-7-3-4-9-17(14)26-18/h3-4,7,9,11-12,16H,2,5-6,8,10,13H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | QCYWFCWVUBZXCY-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |