C18H25N3 — CID 42529056
(3R)-1-(1H-imidazol-2-ylmethyl)-3-[2-(2-methylphenyl)ethyl]piperidine (PubChem CID 42529056) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is (3R)-1-(1H-imidazol-2-ylmethyl)-3-[2-(2-methylphenyl)ethyl]piperidine.
| Compound Name | (3R)-1-(1H-imidazol-2-ylmethyl)-3-[2-(2-methylphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 42529056 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (3R)-1-(1H-imidazol-2-ylmethyl)-3-[2-(2-methylphenyl)ethyl]piperidine |
| SMILES | Cc1ccccc1CC[C@@H]1CCCN(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C18H25N3/c1-15-5-2-3-7-17(15)9-8-16-6-4-12-21(13-16)14-18-19-10-11-20-18/h2-3,5,7,10-11,16H,4,6,8-9,12-14H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | QCKDVNJBNBPFOS-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |