C18H16FN3 — CID 4253034
N-benzyl-6-(2-fluorophenyl)-2-methylpyrimidin-4-amine (PubChem CID 4253034) has the molecular formula C18H16FN3 and a molecular weight of 293.35 g/mol. Its IUPAC name is N-benzyl-6-(2-fluorophenyl)-2-methylpyrimidin-4-amine.
| Compound Name | N-benzyl-6-(2-fluorophenyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4253034 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-benzyl-6-(2-fluorophenyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NCc2ccccc2)cc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C18H16FN3/c1-13-21-17(15-9-5-6-10-16(15)19)11-18(22-13)20-12-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,20,21,22) |
| InChIKey | JRPLUICBDONNHW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |