C24H26N4O — CID 42530705
2-methyl-4-[4-[[[(4R)-1-pyridin-2-yl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]phenyl]but-3-yn-2-ol (PubChem CID 42530705) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-methyl-4-[4-[[[(4R)-1-pyridin-2-yl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]phenyl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[4-[[[(4R)-1-pyridin-2-yl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 42530705 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-methyl-4-[4-[[[(4R)-1-pyridin-2-yl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]phenyl]but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc(CN[C@@H]2CCCc3c2cnn3-c2ccccn2)cc1 |
| InChI | InChI=1S/C24H26N4O/c1-24(2,29)14-13-18-9-11-19(12-10-18)16-26-21-6-5-7-22-20(21)17-27-28(22)23-8-3-4-15-25-23/h3-4,8-12,15,17,21,26,29H,5-7,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | XNOJOKBJLOZXTH-OAQYLSRUSA-N |
| XLogP | 3.56 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|