C24H37N3O3 — CID 42533077
methyl (4S)-4-[4-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]piperidin-1-yl]pentanoate (PubChem CID 42533077) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is methyl (4S)-4-[4-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]piperidin-1-yl]pentanoate.
| Compound Name | methyl (4S)-4-[4-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 42533077 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | methyl (4S)-4-[4-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]piperidin-1-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)N1CCC(CCC(=O)N2CCN(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H37N3O3/c1-20(8-11-24(29)30-2)25-14-12-21(13-15-25)9-10-23(28)27-18-16-26(17-19-27)22-6-4-3-5-7-22/h3-7,20-21H,8-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | SNLKPZKGLKZJSA-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |