C20H18ClN3O3S — CID 42534534
(7Z)-7-[(2-chlorophenyl)methylidene]-3-(3,4-dimethoxyphenyl)-2,4-dihydroimidazo[2,1-b][1,3,5]thiadiazin-6-one (PubChem CID 42534534) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is (7Z)-7-[(2-chlorophenyl)methylidene]-3-(3,4-dimethoxyphenyl)-2,4-dihydroimidazo[2,1-b][1,3,5]thiadiazin-6-one.
| Compound Name | (7Z)-7-[(2-chlorophenyl)methylidene]-3-(3,4-dimethoxyphenyl)-2,4-dihydroimidazo[2,1-b][1,3,5]thiadiazin-6-one |
|---|---|
| PubChem CID | 42534534 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (7Z)-7-[(2-chlorophenyl)methylidene]-3-(3,4-dimethoxyphenyl)-2,4-dihydroimidazo[2,1-b][1,3,5]thiadiazin-6-one |
| SMILES | COc1ccc(N2CSC3=N/C(=C\c4ccccc4Cl)C(=O)N3C2)cc1OC |
| InChI | InChI=1S/C20H18ClN3O3S/c1-26-17-8-7-14(10-18(17)27-2)23-11-24-19(25)16(22-20(24)28-12-23)9-13-5-3-4-6-15(13)21/h3-10H,11-12H2,1-2H3/b16-9- |
| InChIKey | AHWYLKJPFOGTNX-SXGWCWSVSA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|