C18H23N5O2 — CID 42534995
N-[3-(diethylamino)propyl]-3-(1H-indol-4-yl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 42534995) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-3-(1H-indol-4-yl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-3-(1H-indol-4-yl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 42534995 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-3-(1H-indol-4-yl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1nc(-c2cccc3[nH]ccc23)no1 |
| InChI | InChI=1S/C18H23N5O2/c1-3-23(4-2)12-6-10-20-17(24)18-21-16(22-25-18)14-7-5-8-15-13(14)9-11-19-15/h5,7-9,11,19H,3-4,6,10,12H2,1-2H3,(H,20,24) |
| InChIKey | WUUCGNPZZFTMOP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|