C15H23N5O4 — CID 42535181
N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 42535181) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 42535181 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Nc2c[nH]c(=O)[nH]c2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C15H23N5O4/c1-14(2)5-8(6-15(3,4)20-14)17-11(22)12(23)18-9-7-16-13(24)19-10(9)21/h7-8,20H,5-6H2,1-4H3,(H,17,22)(H,18,23)(H2,16,19,21,24) |
| InChIKey | OXNWTLUNKRGHGD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|