C23H21N3O5 — CID 42536058
3-(7-methoxy-4-methyl-2-oxochromen-6-yl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide (PubChem CID 42536058) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-6-yl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-6-yl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 42536058 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-6-yl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
| SMILES | COc1cc2oc(=O)cc(C)c2cc1CCC(=O)NCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C23H21N3O5/c1-14-10-22(28)30-19-12-18(29-2)16(11-17(14)19)8-9-20(27)24-13-21-25-23(26-31-21)15-6-4-3-5-7-15/h3-7,10-12H,8-9,13H2,1-2H3,(H,24,27) |
| InChIKey | IGCYHZIERUSIJW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|