C10H7ClN4O — CID 42536764
6-chloro-N-(cyanomethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 42536764) has the molecular formula C10H7ClN4O and a molecular weight of 234.65 g/mol. Its IUPAC name is 6-chloro-N-(cyanomethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(cyanomethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42536764 |
| Molecular Formula | C10H7ClN4O |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 6-chloro-N-(cyanomethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | N#CCNC(=O)c1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C10H7ClN4O/c11-7-1-2-9-14-8(6-15(9)5-7)10(16)13-4-3-12/h1-2,5-6H,4H2,(H,13,16) |
| InChIKey | VQGPYLUUAKPVAV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|