C17H24FN3O2 — CID 42542998
1-[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl]-N-methylpiperidine-4-carboxamide (PubChem CID 42542998) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 42542998 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(CC(=O)NCc2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-12-3-4-13(9-15(12)18)10-20-16(22)11-21-7-5-14(6-8-21)17(23)19-2/h3-4,9,14H,5-8,10-11H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | UMJWMCXHVGTJPD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |