About 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol
3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol (PubChem CID 4254531) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol.
Molecular Properties
| Compound Name | 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol |
| PubChem CID | 4254531 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol |
| SMILES | [H]/N=c1/c2c(ncn1CCCO)Oc1cc(O)ccc1C2c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-15-6-3-13(4-7-15)18-16-8-5-14(26)11-17(16)28-21-19(18)20(22)24(12-23-21)9-2-10-25/h3-8,11-12,18,22,25-26H,2,9-10H2,1H3/b22-20- |
| InChIKey | CWTCVTRGYVNVBJ-XDOYNYLZSA-N |
| XLogP | 2.75 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol?
The IUPAC name of 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol (CID 4254531) is 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol.
What is the SMILES notation for 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol?
The canonical SMILES for 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol is [H]/N=c1/c2c(ncn1CCCO)Oc1cc(O)ccc1C2c1ccc(OC)cc1.
What is the InChIKey of 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol?
The InChIKey is CWTCVTRGYVNVBJ-XDOYNYLZSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-27-15-6-3-13(4-7-15)18-16-8-5-14(26)11-17(16)28-21-19(18)20(22)24(12-23-21)9-2-10-25/h3-8,11-12,18,22,25-26H,2,9-10H2,1H3/b22-20-.
What are the key properties of 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol?
3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol has a molecular weight of 379.42 g/mol, XLogP of 2.75, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)-4-imino-5-(4-methoxyphenyl)-5H-chromeno[2,3-d]pyrimidin-8-ol is sourced from PubChem (CID 4254531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).